C13H25N3 — CID 62731753
N-[[1-(2-methylpentyl)pyrazol-4-yl]methyl]propan-1-amine (PubChem CID 62731753) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N-[[1-(2-methylpentyl)pyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(2-methylpentyl)pyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62731753 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N-[[1-(2-methylpentyl)pyrazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnn(CC(C)CCC)c1 |
| InChI | InChI=1S/C13H25N3/c1-4-6-12(3)10-16-11-13(9-15-16)8-14-7-5-2/h9,11-12,14H,4-8,10H2,1-3H3 |
| InChIKey | QXSZBGVAZZETFL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|