About N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine
N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine (PubChem CID 64567805) has the molecular formula C10H16F3N3
and a molecular weight of 235.25 g/mol. Its IUPAC name is N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine |
| PubChem CID | 64567805 |
| Molecular Formula | C10H16F3N3 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnn(CCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H16F3N3/c1-2-4-14-6-9-7-15-16(8-9)5-3-10(11,12)13/h7-8,14H,2-6H2,1H3 |
| InChIKey | GINVGSBJLFBWHY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine?
The IUPAC name of N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine (CID 64567805) is N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine.
What is the SMILES notation for N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine?
The canonical SMILES for N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine is CCCNCc1cnn(CCC(F)(F)F)c1.
What is the InChIKey of N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine?
The InChIKey is GINVGSBJLFBWHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3N3/c1-2-4-14-6-9-7-15-16(8-9)5-3-10(11,12)13/h7-8,14H,2-6H2,1H3.
What are the key properties of N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine?
N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine has a molecular weight of 235.25 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(3,3,3-trifluoropropyl)pyrazol-4-yl]methyl]propan-1-amine is sourced from PubChem (CID 64567805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).