C10H17ClF3N3 — CID 126964946
N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]butan-1-amine;hydrochloride (PubChem CID 126964946) has the molecular formula C10H17ClF3N3 and a molecular weight of 271.71 g/mol. Its IUPAC name is N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]butan-1-amine;hydrochloride.
| Compound Name | N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 126964946 |
| Molecular Formula | C10H17ClF3N3 |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]butan-1-amine;hydrochloride |
| SMILES | CCCCNCc1cnn(CC(F)(F)F)c1.Cl |
| InChI | InChI=1S/C10H16F3N3.ClH/c1-2-3-4-14-5-9-6-15-16(7-9)8-10(11,12)13;/h6-7,14H,2-5,8H2,1H3;1H |
| InChIKey | HPLMJZPWKNWOEK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|