C15H19ClF3N3O — CID 126965303
2-(3-methoxyphenyl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]ethanamine;hydrochloride (PubChem CID 126965303) has the molecular formula C15H19ClF3N3O and a molecular weight of 349.78 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-(3-methoxyphenyl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 126965303 |
| Molecular Formula | C15H19ClF3N3O |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]ethanamine;hydrochloride |
| SMILES | COc1cccc(CCNCc2cnn(CC(F)(F)F)c2)c1.Cl |
| InChI | InChI=1S/C15H18F3N3O.ClH/c1-22-14-4-2-3-12(7-14)5-6-19-8-13-9-20-21(10-13)11-15(16,17)18;/h2-4,7,9-10,19H,5-6,8,11H2,1H3;1H |
| InChIKey | VIEPEUWDKCMGFT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|