C11H21Cl2F3N4 — CID 126965096
N',N'-dimethyl-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]propane-1,3-diamine;dihydrochloride (PubChem CID 126965096) has the molecular formula C11H21Cl2F3N4 and a molecular weight of 337.22 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dimethyl-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 126965096 |
| Molecular Formula | C11H21Cl2F3N4 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N',N'-dimethyl-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]propane-1,3-diamine;dihydrochloride |
| SMILES | CN(C)CCCNCc1cnn(CC(F)(F)F)c1.Cl.Cl |
| InChI | InChI=1S/C11H19F3N4.2ClH/c1-17(2)5-3-4-15-6-10-7-16-18(8-10)9-11(12,13)14;;/h7-8,15H,3-6,9H2,1-2H3;2*1H |
| InChIKey | HRJUKTBEUUAOKV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|