C17H28Cl2N4 — CID 126968221
N,N-dimethyl-4-[[[1-(2-methylpropyl)pyrazol-4-yl]methylamino]methyl]aniline;dihydrochloride (PubChem CID 126968221) has the molecular formula C17H28Cl2N4 and a molecular weight of 359.35 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[1-(2-methylpropyl)pyrazol-4-yl]methylamino]methyl]aniline;dihydrochloride.
| Compound Name | N,N-dimethyl-4-[[[1-(2-methylpropyl)pyrazol-4-yl]methylamino]methyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 126968221 |
| Molecular Formula | C17H28Cl2N4 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N,N-dimethyl-4-[[[1-(2-methylpropyl)pyrazol-4-yl]methylamino]methyl]aniline;dihydrochloride |
| SMILES | CC(C)Cn1cc(CNCc2ccc(N(C)C)cc2)cn1.Cl.Cl |
| InChI | InChI=1S/C17H26N4.2ClH/c1-14(2)12-21-13-16(11-19-21)10-18-9-15-5-7-17(8-6-15)20(3)4;;/h5-8,11,13-14,18H,9-10,12H2,1-4H3;2*1H |
| InChIKey | ZLNSYROIPCIYAA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|