C13H19F2N5 — CID 122167209
1-[2-(difluoromethyl)pyrazol-3-yl]-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]methanamine (PubChem CID 122167209) has the molecular formula C13H19F2N5 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[2-(difluoromethyl)pyrazol-3-yl]-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]methanamine.
| Compound Name | 1-[2-(difluoromethyl)pyrazol-3-yl]-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]methanamine |
|---|---|
| PubChem CID | 122167209 |
| Molecular Formula | C13H19F2N5 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-[2-(difluoromethyl)pyrazol-3-yl]-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]methanamine |
| SMILES | CC(C)Cn1cc(CNCc2ccnn2C(F)F)cn1 |
| InChI | InChI=1S/C13H19F2N5/c1-10(2)8-19-9-11(6-18-19)5-16-7-12-3-4-17-20(12)13(14)15/h3-4,6,9-10,13,16H,5,7-8H2,1-2H3 |
| InChIKey | ZWMLSIRRYUUQEY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |