C14H24ClN5 — CID 126967024
1-(2-butan-2-ylpyrazol-3-yl)-N-[(1-ethylpyrazol-4-yl)methyl]methanamine;hydrochloride (PubChem CID 126967024) has the molecular formula C14H24ClN5 and a molecular weight of 297.83 g/mol. Its IUPAC name is 1-(2-butan-2-ylpyrazol-3-yl)-N-[(1-ethylpyrazol-4-yl)methyl]methanamine;hydrochloride.
| Compound Name | 1-(2-butan-2-ylpyrazol-3-yl)-N-[(1-ethylpyrazol-4-yl)methyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 126967024 |
| Molecular Formula | C14H24ClN5 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-(2-butan-2-ylpyrazol-3-yl)-N-[(1-ethylpyrazol-4-yl)methyl]methanamine;hydrochloride |
| SMILES | CCC(C)n1nccc1CNCc1cnn(CC)c1.Cl |
| InChI | InChI=1S/C14H23N5.ClH/c1-4-12(3)19-14(6-7-16-19)10-15-8-13-9-17-18(5-2)11-13;/h6-7,9,11-12,15H,4-5,8,10H2,1-3H3;1H |
| InChIKey | JVJNXNSPDOGRKO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |