C13H25ClN4O — CID 120961946
4-[[[1-(2-methylpropyl)pyrazol-4-yl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride (PubChem CID 120961946) has the molecular formula C13H25ClN4O and a molecular weight of 288.82 g/mol. Its IUPAC name is 4-[[[1-(2-methylpropyl)pyrazol-4-yl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride.
| Compound Name | 4-[[[1-(2-methylpropyl)pyrazol-4-yl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 120961946 |
| Molecular Formula | C13H25ClN4O |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 4-[[[1-(2-methylpropyl)pyrazol-4-yl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
| SMILES | CC(C)Cn1cc(CNCC2CNCC2O)cn1.Cl |
| InChI | InChI=1S/C13H24N4O.ClH/c1-10(2)8-17-9-11(4-16-17)3-14-5-12-6-15-7-13(12)18;/h4,9-10,12-15,18H,3,5-8H2,1-2H3;1H |
| InChIKey | OTVYDKAORIOMFH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |