C15H25ClN2O2 — CID 120962514
4-[[(4-propan-2-yloxyphenyl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride (PubChem CID 120962514) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 4-[[(4-propan-2-yloxyphenyl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride.
| Compound Name | 4-[[(4-propan-2-yloxyphenyl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 120962514 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 4-[[(4-propan-2-yloxyphenyl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
| SMILES | CC(C)Oc1ccc(CNCC2CNCC2O)cc1.Cl |
| InChI | InChI=1S/C15H24N2O2.ClH/c1-11(2)19-14-5-3-12(4-6-14)7-16-8-13-9-17-10-15(13)18;/h3-6,11,13,15-18H,7-10H2,1-2H3;1H |
| InChIKey | OJUXDFYQOGWRBK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |