C22H20N4O3 — CID 122193593
4-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide (PubChem CID 122193593) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 122193593 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(Cn2nnc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H20N4O3/c1-3-25(4-2)22(29)15-11-9-14(10-12-15)13-26-19-18(23-24-26)20(27)16-7-5-6-8-17(16)21(19)28/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | KRDFDYRCPIZNRJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|