C17H12ClN3S — CID 122193774
N-(4-chlorophenyl)-5H-thiochromeno[4,3-d]pyrimidin-2-amine (PubChem CID 122193774) has the molecular formula C17H12ClN3S and a molecular weight of 325.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5H-thiochromeno[4,3-d]pyrimidin-2-amine.
| Compound Name | N-(4-chlorophenyl)-5H-thiochromeno[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 122193774 |
| Molecular Formula | C17H12ClN3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-(4-chlorophenyl)-5H-thiochromeno[4,3-d]pyrimidin-2-amine |
| SMILES | Clc1ccc(Nc2ncc3c(n2)-c2ccccc2SC3)cc1 |
| InChI | InChI=1S/C17H12ClN3S/c18-12-5-7-13(8-6-12)20-17-19-9-11-10-22-15-4-2-1-3-14(15)16(11)21-17/h1-9H,10H2,(H,19,20,21) |
| InChIKey | IEPMWOYSCMMVNR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |