C28H23Cl3N6O — CID 122193883
2,6-dichloro-N-[(2R)-2-(3-chlorophenyl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide (PubChem CID 122193883) has the molecular formula C28H23Cl3N6O and a molecular weight of 565.89 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2R)-2-(3-chlorophenyl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide.
| Compound Name | 2,6-dichloro-N-[(2R)-2-(3-chlorophenyl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 122193883 |
| Molecular Formula | C28H23Cl3N6O |
| Molecular Weight | 565.89 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 2,6-dichloro-N-[(2R)-2-(3-chlorophenyl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide |
| SMILES | Cc1ccc2c3c(nn2c1)CC[C@](NC(=O)c1c(Cl)cc(-n2cnc(C)n2)cc1Cl)(c1cccc(Cl)c1)C3 |
| InChI | InChI=1S/C28H23Cl3N6O/c1-16-6-7-25-21-13-28(18-4-3-5-19(29)10-18,9-8-24(21)35-36(25)14-16)33-27(38)26-22(30)11-20(12-23(26)31)37-15-32-17(2)34-37/h3-7,10-12,14-15H,8-9,13H2,1-2H3,(H,33,38)/t28-/m1/s1 |
| InChIKey | FRVGYXZANHABGS-MUUNZHRXSA-N |
| XLogP | 6.31 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.89 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |