C22H26O2S2 — CID 122194122
4-[1,5-dithiaspiro[5.5]undecan-10-yl-(4-hydroxyphenyl)methyl]phenol (PubChem CID 122194122) has the molecular formula C22H26O2S2 and a molecular weight of 386.58 g/mol. Its IUPAC name is 4-[1,5-dithiaspiro[5.5]undecan-10-yl-(4-hydroxyphenyl)methyl]phenol.
| Compound Name | 4-[1,5-dithiaspiro[5.5]undecan-10-yl-(4-hydroxyphenyl)methyl]phenol |
|---|---|
| PubChem CID | 122194122 |
| Molecular Formula | C22H26O2S2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-[1,5-dithiaspiro[5.5]undecan-10-yl-(4-hydroxyphenyl)methyl]phenol |
| SMILES | Oc1ccc(C(c2ccc(O)cc2)C2CCCC3(C2)SCCCS3)cc1 |
| InChI | InChI=1S/C22H26O2S2/c23-19-8-4-16(5-9-19)21(17-6-10-20(24)11-7-17)18-3-1-12-22(15-18)25-13-2-14-26-22/h4-11,18,21,23-24H,1-3,12-15H2 |
| InChIKey | CLQHGPPNUOFPLP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |