C26H21FN2O4S — CID 122195322
7-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one (PubChem CID 122195322) has the molecular formula C26H21FN2O4S and a molecular weight of 476.53 g/mol. Its IUPAC name is 7-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one.
| Compound Name | 7-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 122195322 |
| Molecular Formula | C26H21FN2O4S |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 7-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]butoxy]-5-hydroxy-2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(OCCCCNc3nc4ccc(F)cc4s3)cc(O)c12 |
| InChI | InChI=1S/C26H21FN2O4S/c27-17-8-9-19-24(12-17)34-26(29-19)28-10-4-5-11-32-18-13-20(30)25-21(31)15-22(33-23(25)14-18)16-6-2-1-3-7-16/h1-3,6-9,12-15,30H,4-5,10-11H2,(H,28,29) |
| InChIKey | FGGFGSOQLKBLCP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|