C18H27N3O3 — CID 122196259
ethyl 6-[4-(dimethylamino)phenyl]-1,4,5-trimethyl-2-oxo-1,3-diazinane-5-carboxylate (PubChem CID 122196259) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is ethyl 6-[4-(dimethylamino)phenyl]-1,4,5-trimethyl-2-oxo-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl 6-[4-(dimethylamino)phenyl]-1,4,5-trimethyl-2-oxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 122196259 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | ethyl 6-[4-(dimethylamino)phenyl]-1,4,5-trimethyl-2-oxo-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)C1(C)C(C)NC(=O)N(C)C1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H27N3O3/c1-7-24-16(22)18(3)12(2)19-17(23)21(6)15(18)13-8-10-14(11-9-13)20(4)5/h8-12,15H,7H2,1-6H3,(H,19,23) |
| InChIKey | QWEGDTKWVOIOJG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|