C20H30N4O3 — CID 40791300
ethyl (4S)-6-[[[4-(dimethylamino)phenyl]methyl-ethylamino]methyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 40791300) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is ethyl (4S)-6-[[[4-(dimethylamino)phenyl]methyl-ethylamino]methyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-6-[[[4-(dimethylamino)phenyl]methyl-ethylamino]methyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 40791300 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | ethyl (4S)-6-[[[4-(dimethylamino)phenyl]methyl-ethylamino]methyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN(CC)Cc2ccc(N(C)C)cc2)NC(=O)N[C@H]1C |
| InChI | InChI=1S/C20H30N4O3/c1-6-24(12-15-8-10-16(11-9-15)23(4)5)13-17-18(19(25)27-7-2)14(3)21-20(26)22-17/h8-11,14H,6-7,12-13H2,1-5H3,(H2,21,22,26)/t14-/m0/s1 |
| InChIKey | HKMAYNGTTCXKMW-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|