C22H32N4O3 — CID 55432093
ethyl 4-methyl-6-[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 55432093) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is ethyl 4-methyl-6-[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-methyl-6-[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 55432093 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | ethyl 4-methyl-6-[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN(C)Cc2ccc(N3CCCCC3)cc2)NC(=O)NC1C |
| InChI | InChI=1S/C22H32N4O3/c1-4-29-21(27)20-16(2)23-22(28)24-19(20)15-25(3)14-17-8-10-18(11-9-17)26-12-6-5-7-13-26/h8-11,16H,4-7,12-15H2,1-3H3,(H2,23,24,28) |
| InChIKey | AFKZCVKEHOHUTO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|