C25H34ClF2N5O — CID 122196554
6-chloro-2-[4-(4,4-difluoropiperidin-1-yl)butylamino]-N-(2-pyrrolidin-1-ylethyl)quinoline-4-carboxamide (PubChem CID 122196554) has the molecular formula C25H34ClF2N5O and a molecular weight of 494.03 g/mol. Its IUPAC name is 6-chloro-2-[4-(4,4-difluoropiperidin-1-yl)butylamino]-N-(2-pyrrolidin-1-ylethyl)quinoline-4-carboxamide.
| Compound Name | 6-chloro-2-[4-(4,4-difluoropiperidin-1-yl)butylamino]-N-(2-pyrrolidin-1-ylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 122196554 |
| Molecular Formula | C25H34ClF2N5O |
| Molecular Weight | 494.03 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 6-chloro-2-[4-(4,4-difluoropiperidin-1-yl)butylamino]-N-(2-pyrrolidin-1-ylethyl)quinoline-4-carboxamide |
| SMILES | O=C(NCCN1CCCC1)c1cc(NCCCCN2CCC(F)(F)CC2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C25H34ClF2N5O/c26-19-5-6-22-20(17-19)21(24(34)30-10-16-32-12-3-4-13-32)18-23(31-22)29-9-1-2-11-33-14-7-25(27,28)8-15-33/h5-6,17-18H,1-4,7-16H2,(H,29,31)(H,30,34) |
| InChIKey | BDFAHNBRQVAVII-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.03 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|