C20H27N5O2 — CID 122198058
[1-(6-isocyano-2-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate (PubChem CID 122198058) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is [1-(6-isocyano-2-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate.
| Compound Name | [1-(6-isocyano-2-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 122198058 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | [1-(6-isocyano-2-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1cccc(N2CCC(OC(=O)N3CCN(C4CCC4)CC3)CC2)n1 |
| InChI | InChI=1S/C20H27N5O2/c1-21-18-6-3-7-19(22-18)24-10-8-17(9-11-24)27-20(26)25-14-12-23(13-15-25)16-4-2-5-16/h3,6-7,16-17H,2,4-5,8-15H2 |
| InChIKey | NISFSIYBYOSTRE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|