C18H27FN4O2 — CID 89487403
[1-(4-fluoro-2-pyridinyl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate (PubChem CID 89487403) has the molecular formula C18H27FN4O2 and a molecular weight of 350.44 g/mol. Its IUPAC name is [1-(4-fluoro-2-pyridinyl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate.
| Compound Name | [1-(4-fluoro-2-pyridinyl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 89487403 |
| Molecular Formula | C18H27FN4O2 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [1-(4-fluoro-2-pyridinyl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate |
| SMILES | CC(C)N1CCN(C(=O)OC2CCN(c3cc(F)ccn3)CC2)CC1 |
| InChI | InChI=1S/C18H27FN4O2/c1-14(2)21-9-11-23(12-10-21)18(24)25-16-4-7-22(8-5-16)17-13-15(19)3-6-20-17/h3,6,13-14,16H,4-5,7-12H2,1-2H3 |
| InChIKey | UWSVLFXLYUEJDS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |