C52H57N3O4S2 — CID 122206019
2,5-bis(2-ethylhexyl)-4-[5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]thiophen-2-yl]-1-thiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 122206019) has the molecular formula C52H57N3O4S2 and a molecular weight of 852.18 g/mol. Its IUPAC name is 2,5-bis(2-ethylhexyl)-4-[5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]thiophen-2-yl]-1-thiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-bis(2-ethylhexyl)-4-[5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]thiophen-2-yl]-1-thiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 122206019 |
| Molecular Formula | C52H57N3O4S2 |
| Molecular Weight | 852.18 g/mol |
| Exact Mass | 851.38 |
| IUPAC Name | 2,5-bis(2-ethylhexyl)-4-[5-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]thiophen-2-yl]-1-thiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCC(CC)CN1C(=O)C2=C(c3ccc(C#Cc4ccc(N(c5ccc(OC)cc5)c5ccc(OC)cc5)cc4)s3)N(CC(CC)CCCC)C(=O)C2=C1c1cccs1 |
| InChI | InChI=1S/C52H57N3O4S2/c1-7-11-14-36(9-3)34-53-49(45-16-13-33-60-45)47-48(52(53)57)50(54(51(47)56)35-37(10-4)15-12-8-2)46-32-31-44(61-46)30-19-38-17-20-39(21-18-38)55(40-22-26-42(58-5)27-23-40)41-24-28-43(59-6)29-25-41/h13,16-18,20-29,31-33,36-37H,7-12,14-15,34-35H2,1-6H3 |
| InChIKey | GVOLGIVJGYIPTN-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.18 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|