C70H74N4O6S2 — CID 135027076
2,5-bis(2-ethylhexyl)-1,4-bis[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 135027076) has the molecular formula C70H74N4O6S2 and a molecular weight of 1131.52 g/mol. Its IUPAC name is 2,5-bis(2-ethylhexyl)-1,4-bis[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-bis(2-ethylhexyl)-1,4-bis[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 135027076 |
| Molecular Formula | C70H74N4O6S2 |
| Molecular Weight | 1131.52 g/mol |
| Exact Mass | 1130.50 |
| IUPAC Name | 2,5-bis(2-ethylhexyl)-1,4-bis[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCC(CC)CN1C(=O)C2=C(c3ccc(-c4ccc(N(c5ccc(OC)cc5)c5ccc(OC)cc5)cc4)s3)N(CC(CC)CCCC)C(=O)C2=C1c1ccc(-c2ccc(N(c3ccc(OC)cc3)c3ccc(OC)cc3)cc2)s1 |
| InChI | InChI=1S/C70H74N4O6S2/c1-9-13-15-47(11-3)45-71-67(63-43-41-61(81-63)49-17-21-51(22-18-49)73(53-25-33-57(77-5)34-26-53)54-27-35-58(78-6)36-28-54)65-66(69(71)75)68(72(70(65)76)46-48(12-4)16-14-10-2)64-44-42-62(82-64)50-19-23-52(24-20-50)74(55-29-37-59(79-7)38-30-55)56-31-39-60(80-8)40-32-56/h17-44,47-48H,9-16,45-46H2,1-8H3 |
| InChIKey | CSDXYGUHXKCFSP-UHFFFAOYSA-N |
| XLogP | 18.36 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1131.52 |
| LogP ≤ 5 | 18.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|