C48H38N2O4S3 — CID 132609878
4-[10-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-N,N-bis(4-methoxyphenyl)aniline (PubChem CID 132609878) has the molecular formula C48H38N2O4S3 and a molecular weight of 803.04 g/mol. Its IUPAC name is 4-[10-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-N,N-bis(4-methoxyphenyl)aniline.
| Compound Name | 4-[10-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-N,N-bis(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 132609878 |
| Molecular Formula | C48H38N2O4S3 |
| Molecular Weight | 803.04 g/mol |
| Exact Mass | 802.20 |
| IUPAC Name | 4-[10-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-N,N-bis(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(-c3cc4sc5cc(-c6ccc(N(c7ccc(OC)cc7)c7ccc(OC)cc7)cc6)sc5c4s3)cc2)cc1 |
| InChI | InChI=1S/C48H38N2O4S3/c1-51-39-21-13-35(14-22-39)49(36-15-23-40(52-2)24-16-36)33-9-5-31(6-10-33)43-29-45-47(56-43)48-46(55-45)30-44(57-48)32-7-11-34(12-8-32)50(37-17-25-41(53-3)26-18-37)38-19-27-42(54-4)28-20-38/h5-30H,1-4H3 |
| InChIKey | SVQSVWRQDKLAEJ-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.04 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |