About 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline
4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline (PubChem CID 122480460) has the molecular formula C31H23NOS2
and a molecular weight of 489.67 g/mol. Its IUPAC name is 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline.
Molecular Properties
| Compound Name | 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline |
| PubChem CID | 122480460 |
| Molecular Formula | C31H23NOS2 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline |
| SMILES | COc1ccc(-c2c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)sc3ccsc23)cc1 |
| InChI | InChI=1S/C31H23NOS2/c1-33-27-18-14-22(15-19-27)29-30(35-28-20-21-34-31(28)29)23-12-16-26(17-13-23)32(24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-21H,1H3 |
| InChIKey | NZBMJXKYUQEONR-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline?
The IUPAC name of 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline (CID 122480460) is 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline.
What is the SMILES notation for 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline?
The canonical SMILES for 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline is COc1ccc(-c2c(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)sc3ccsc23)cc1.
What is the InChIKey of 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline?
The InChIKey is NZBMJXKYUQEONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H23NOS2/c1-33-27-18-14-22(15-19-27)29-30(35-28-20-21-34-31(28)29)23-12-16-26(17-13-23)32(24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-21H,1H3.
What are the key properties of 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline?
4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline has a molecular weight of 489.67 g/mol, XLogP of 9.78, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]-N,N-diphenylaniline is sourced from PubChem (CID 122480460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).