C17H11F4N3S — CID 122206373
N-(4-fluorophenyl)-4-phenylsulfanyl-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 122206373) has the molecular formula C17H11F4N3S and a molecular weight of 365.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-phenylsulfanyl-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(4-fluorophenyl)-4-phenylsulfanyl-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 122206373 |
| Molecular Formula | C17H11F4N3S |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(4-fluorophenyl)-4-phenylsulfanyl-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Fc1ccc(Nc2ncc(C(F)(F)F)c(Sc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H11F4N3S/c18-11-6-8-12(9-7-11)23-16-22-10-14(17(19,20)21)15(24-16)25-13-4-2-1-3-5-13/h1-10H,(H,22,23,24) |
| InChIKey | WCRJUPVJELAXKM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |