C19H16F3N3O — CID 122206381
N-methyl-N-phenyl-2-phenylmethoxy-5-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 122206381) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is N-methyl-N-phenyl-2-phenylmethoxy-5-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-methyl-N-phenyl-2-phenylmethoxy-5-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 122206381 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-methyl-N-phenyl-2-phenylmethoxy-5-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CN(c1ccccc1)c1nc(OCc2ccccc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C19H16F3N3O/c1-25(15-10-6-3-7-11-15)17-16(19(20,21)22)12-23-18(24-17)26-13-14-8-4-2-5-9-14/h2-12H,13H2,1H3 |
| InChIKey | SUHGANDNTPOCSQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |