C21H15N5O2 — CID 122207433
5-(2,2-diphenylethenyl)-1-(4-nitrophenyl)tetrazole (PubChem CID 122207433) has the molecular formula C21H15N5O2 and a molecular weight of 369.38 g/mol. Its IUPAC name is 5-(2,2-diphenylethenyl)-1-(4-nitrophenyl)tetrazole.
| Compound Name | 5-(2,2-diphenylethenyl)-1-(4-nitrophenyl)tetrazole |
|---|---|
| PubChem CID | 122207433 |
| Molecular Formula | C21H15N5O2 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 5-(2,2-diphenylethenyl)-1-(4-nitrophenyl)tetrazole |
| SMILES | O=[N+]([O-])c1ccc(-n2nnnc2C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15N5O2/c27-26(28)19-13-11-18(12-14-19)25-21(22-23-24-25)15-20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15H |
| InChIKey | ZDYLZHZHZZVPHA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|