C22H18N4 — CID 122207425
5-(2,2-diphenylethenyl)-1-(3-methylphenyl)tetrazole (PubChem CID 122207425) has the molecular formula C22H18N4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 5-(2,2-diphenylethenyl)-1-(3-methylphenyl)tetrazole.
| Compound Name | 5-(2,2-diphenylethenyl)-1-(3-methylphenyl)tetrazole |
|---|---|
| PubChem CID | 122207425 |
| Molecular Formula | C22H18N4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 5-(2,2-diphenylethenyl)-1-(3-methylphenyl)tetrazole |
| SMILES | Cc1cccc(-n2nnnc2C=C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H18N4/c1-17-9-8-14-20(15-17)26-22(23-24-25-26)16-21(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-16H,1H3 |
| InChIKey | AYENYHMACLIYME-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |