C18H15NO — CID 122208052
(4R)-3-phenylspiro[cyclopent-2-ene-4,3'-indole]-1-ol (PubChem CID 122208052) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is (4R)-3-phenylspiro[cyclopent-2-ene-4,3'-indole]-1-ol.
| Compound Name | (4R)-3-phenylspiro[cyclopent-2-ene-4,3'-indole]-1-ol |
|---|---|
| PubChem CID | 122208052 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (4R)-3-phenylspiro[cyclopent-2-ene-4,3'-indole]-1-ol |
| SMILES | OC1C=C(c2ccccc2)[C@]2(C=Nc3ccccc32)C1 |
| InChI | InChI=1S/C18H15NO/c20-14-10-16(13-6-2-1-3-7-13)18(11-14)12-19-17-9-5-4-8-15(17)18/h1-10,12,14,20H,11H2/t14?,18-/m0/s1 |
| InChIKey | UOMJVCAWNWIXRH-IBYPIGCZSA-N |
| XLogP | 3.49 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |