C28H21F4IN2O4 — CID 122209435
[8-benzamido-4-(2-methylpropoxy)quinolin-2-yl]methyl 2,3,4,5-tetrafluoro-6-iodobenzoate (PubChem CID 122209435) has the molecular formula C28H21F4IN2O4 and a molecular weight of 652.38 g/mol. Its IUPAC name is [8-benzamido-4-(2-methylpropoxy)quinolin-2-yl]methyl 2,3,4,5-tetrafluoro-6-iodobenzoate.
| Compound Name | [8-benzamido-4-(2-methylpropoxy)quinolin-2-yl]methyl 2,3,4,5-tetrafluoro-6-iodobenzoate |
|---|---|
| PubChem CID | 122209435 |
| Molecular Formula | C28H21F4IN2O4 |
| Molecular Weight | 652.38 g/mol |
| Exact Mass | 652.05 |
| IUPAC Name | [8-benzamido-4-(2-methylpropoxy)quinolin-2-yl]methyl 2,3,4,5-tetrafluoro-6-iodobenzoate |
| SMILES | CC(C)COc1cc(COC(=O)c2c(F)c(F)c(F)c(F)c2I)nc2c(NC(=O)c3ccccc3)cccc12 |
| InChI | InChI=1S/C28H21F4IN2O4/c1-14(2)12-38-19-11-16(13-39-28(37)20-21(29)22(30)23(31)24(32)25(20)33)34-26-17(19)9-6-10-18(26)35-27(36)15-7-4-3-5-8-15/h3-11,14H,12-13H2,1-2H3,(H,35,36) |
| InChIKey | XWLZOPHWXNSKAL-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.38 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|