C28H22F5N3O3 — CID 71740253
8-benzamido-4-(2-methylpropoxy)-N-[(2,3,4,5,6-pentafluorophenyl)methyl]quinoline-2-carboxamide (PubChem CID 71740253) has the molecular formula C28H22F5N3O3 and a molecular weight of 543.49 g/mol. Its IUPAC name is 8-benzamido-4-(2-methylpropoxy)-N-[(2,3,4,5,6-pentafluorophenyl)methyl]quinoline-2-carboxamide.
| Compound Name | 8-benzamido-4-(2-methylpropoxy)-N-[(2,3,4,5,6-pentafluorophenyl)methyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71740253 |
| Molecular Formula | C28H22F5N3O3 |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 8-benzamido-4-(2-methylpropoxy)-N-[(2,3,4,5,6-pentafluorophenyl)methyl]quinoline-2-carboxamide |
| SMILES | CC(C)COc1cc(C(=O)NCc2c(F)c(F)c(F)c(F)c2F)nc2c(NC(=O)c3ccccc3)cccc12 |
| InChI | InChI=1S/C28H22F5N3O3/c1-14(2)13-39-20-11-19(28(38)34-12-17-21(29)23(31)25(33)24(32)22(17)30)35-26-16(20)9-6-10-18(26)36-27(37)15-7-4-3-5-8-15/h3-11,14H,12-13H2,1-2H3,(H,34,38)(H,36,37) |
| InChIKey | BGXGLOOHTNQAFG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|