C11H9F3O2 — CID 122211195
(E)-4,4,4-trifluoro-2-(3-methoxyphenyl)but-2-enal (PubChem CID 122211195) has the molecular formula C11H9F3O2 and a molecular weight of 230.19 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-2-(3-methoxyphenyl)but-2-enal.
| Compound Name | (E)-4,4,4-trifluoro-2-(3-methoxyphenyl)but-2-enal |
|---|---|
| PubChem CID | 122211195 |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (E)-4,4,4-trifluoro-2-(3-methoxyphenyl)but-2-enal |
| SMILES | COc1cccc(/C(C=O)=C\C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F3O2/c1-16-10-4-2-3-8(5-10)9(7-15)6-11(12,13)14/h2-7H,1H3/b9-6- |
| InChIKey | YZZWDXUZYGYXQB-TWGQIWQCSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|