C18H16ClF3 — CID 122213084
1-[(E)-1-(4-chlorophenyl)-4,4,4-trifluorobut-2-enyl]-2,4-dimethylbenzene (PubChem CID 122213084) has the molecular formula C18H16ClF3 and a molecular weight of 324.77 g/mol. Its IUPAC name is 1-[(E)-1-(4-chlorophenyl)-4,4,4-trifluorobut-2-enyl]-2,4-dimethylbenzene.
| Compound Name | 1-[(E)-1-(4-chlorophenyl)-4,4,4-trifluorobut-2-enyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 122213084 |
| Molecular Formula | C18H16ClF3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-[(E)-1-(4-chlorophenyl)-4,4,4-trifluorobut-2-enyl]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C(/C=C/C(F)(F)F)c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C18H16ClF3/c1-12-3-8-16(13(2)11-12)17(9-10-18(20,21)22)14-4-6-15(19)7-5-14/h3-11,17H,1-2H3/b10-9+ |
| InChIKey | KSAUPEZRBDLKHI-MDZDMXLPSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|