C15H16O4 — CID 122214240
ethyl (1S,4R,5S)-7-oxo-5-phenyl-6-oxabicyclo[3.2.0]heptane-4-carboxylate (PubChem CID 122214240) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is ethyl (1S,4R,5S)-7-oxo-5-phenyl-6-oxabicyclo[3.2.0]heptane-4-carboxylate.
| Compound Name | ethyl (1S,4R,5S)-7-oxo-5-phenyl-6-oxabicyclo[3.2.0]heptane-4-carboxylate |
|---|---|
| PubChem CID | 122214240 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | ethyl (1S,4R,5S)-7-oxo-5-phenyl-6-oxabicyclo[3.2.0]heptane-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H]2C(=O)O[C@@]21c1ccccc1 |
| InChI | InChI=1S/C15H16O4/c1-2-18-13(16)11-8-9-12-14(17)19-15(11,12)10-6-4-3-5-7-10/h3-7,11-12H,2,8-9H2,1H3/t11-,12+,15+/m0/s1 |
| InChIKey | JMDLFCWCWIBBDH-YWPYICTPSA-N |
| XLogP | 2.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|