C20H28O5 — CID 24814612
(5S,8S,9S)-9-hydroxy-8-(2-hydroxypropan-2-yl)-9-(2-phenylmethoxyethyl)-2-oxaspiro[4.4]nonan-1-one (PubChem CID 24814612) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (5S,8S,9S)-9-hydroxy-8-(2-hydroxypropan-2-yl)-9-(2-phenylmethoxyethyl)-2-oxaspiro[4.4]nonan-1-one.
| Compound Name | (5S,8S,9S)-9-hydroxy-8-(2-hydroxypropan-2-yl)-9-(2-phenylmethoxyethyl)-2-oxaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 24814612 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (5S,8S,9S)-9-hydroxy-8-(2-hydroxypropan-2-yl)-9-(2-phenylmethoxyethyl)-2-oxaspiro[4.4]nonan-1-one |
| SMILES | CC(C)(O)[C@@H]1CC[C@]2(CCOC2=O)[C@]1(O)CCOCc1ccccc1 |
| InChI | InChI=1S/C20H28O5/c1-18(2,22)16-8-9-19(10-13-25-17(19)21)20(16,23)11-12-24-14-15-6-4-3-5-7-15/h3-7,16,22-23H,8-14H2,1-2H3/t16-,19+,20-/m0/s1 |
| InChIKey | OFIAKQAOEITECT-DBVUQKKJSA-N |
| XLogP | 2.44 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|