C18H20N2O6 — CID 122215087
methyl N-[(3S,4S)-4-(5-methoxy-1-methylindol-3-yl)-2-oxooxane-3-carbonyl]carbamate (PubChem CID 122215087) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl N-[(3S,4S)-4-(5-methoxy-1-methylindol-3-yl)-2-oxooxane-3-carbonyl]carbamate.
| Compound Name | methyl N-[(3S,4S)-4-(5-methoxy-1-methylindol-3-yl)-2-oxooxane-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 122215087 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | methyl N-[(3S,4S)-4-(5-methoxy-1-methylindol-3-yl)-2-oxooxane-3-carbonyl]carbamate |
| SMILES | COC(=O)NC(=O)[C@H]1C(=O)OCC[C@@H]1c1cn(C)c2ccc(OC)cc12 |
| InChI | InChI=1S/C18H20N2O6/c1-20-9-13(12-8-10(24-2)4-5-14(12)20)11-6-7-26-17(22)15(11)16(21)19-18(23)25-3/h4-5,8-9,11,15H,6-7H2,1-3H3,(H,19,21,23)/t11-,15+/m1/s1 |
| InChIKey | NKXYFOJRSUTJSM-ABAIWWIYSA-N |
| XLogP | 1.72 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|