About 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one
2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one (PubChem CID 122215209) has the molecular formula C14H15F3O
and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one |
| PubChem CID | 122215209 |
| Molecular Formula | C14H15F3O |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one |
| SMILES | Cc1ccc(C2(CC(F)(F)F)CCCC2=O)cc1 |
| InChI | InChI=1S/C14H15F3O/c1-10-4-6-11(7-5-10)13(9-14(15,16)17)8-2-3-12(13)18/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | HFERFWBHOIYXHJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one?
The IUPAC name of 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one (CID 122215209) is 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one.
What is the SMILES notation for 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one?
The canonical SMILES for 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one is Cc1ccc(C2(CC(F)(F)F)CCCC2=O)cc1.
What is the InChIKey of 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one?
The InChIKey is HFERFWBHOIYXHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3O/c1-10-4-6-11(7-5-10)13(9-14(15,16)17)8-2-3-12(13)18/h4-7H,2-3,8-9H2,1H3.
What are the key properties of 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one?
2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one has a molecular weight of 256.27 g/mol, XLogP of 3.94, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-2-(2,2,2-trifluoroethyl)cyclopentan-1-one is sourced from PubChem (CID 122215209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).