C20H23N5+2 — CID 122216236
1-methyl-3-[3-(3-methyl-4-phenyltriazol-1-ium-1-yl)propyl]benzimidazol-1-ium (PubChem CID 122216236) has the molecular formula C20H23N5+2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-methyl-3-[3-(3-methyl-4-phenyltriazol-1-ium-1-yl)propyl]benzimidazol-1-ium.
| Compound Name | 1-methyl-3-[3-(3-methyl-4-phenyltriazol-1-ium-1-yl)propyl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 122216236 |
| Molecular Formula | C20H23N5+2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-methyl-3-[3-(3-methyl-4-phenyltriazol-1-ium-1-yl)propyl]benzimidazol-1-ium |
| SMILES | Cn1n[n+](CCCn2c[n+](C)c3ccccc32)cc1-c1ccccc1 |
| InChI | InChI=1S/C20H23N5/c1-22-16-24(19-12-7-6-11-18(19)22)13-8-14-25-15-20(23(2)21-25)17-9-4-3-5-10-17/h3-7,9-12,15-16H,8,13-14H2,1-2H3/q+2 |
| InChIKey | ASNJOCYDCHFFDB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 30.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|