C19H22N4+2 — CID 3815671
1-methyl-3-[3-(3-methylbenzimidazol-3-ium-1-yl)propyl]benzimidazol-1-ium (PubChem CID 3815671) has the molecular formula C19H22N4+2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-methyl-3-[3-(3-methylbenzimidazol-3-ium-1-yl)propyl]benzimidazol-1-ium.
| Compound Name | 1-methyl-3-[3-(3-methylbenzimidazol-3-ium-1-yl)propyl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 3815671 |
| Molecular Formula | C19H22N4+2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1-methyl-3-[3-(3-methylbenzimidazol-3-ium-1-yl)propyl]benzimidazol-1-ium |
| SMILES | C[n+]1cn(CCCn2c[n+](C)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C19H22N4/c1-20-14-22(18-10-5-3-8-16(18)20)12-7-13-23-15-21(2)17-9-4-6-11-19(17)23/h3-6,8-11,14-15H,7,12-13H2,1-2H3/q+2 |
| InChIKey | WDJQTURWFRLERK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|