C30H31NO4 — CID 122216547
(9S)-7-methoxy-9-(3-methoxyphenyl)-N-(4-methoxyphenyl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-imine (PubChem CID 122216547) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is (9S)-7-methoxy-9-(3-methoxyphenyl)-N-(4-methoxyphenyl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-imine.
| Compound Name | (9S)-7-methoxy-9-(3-methoxyphenyl)-N-(4-methoxyphenyl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-imine |
|---|---|
| PubChem CID | 122216547 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (9S)-7-methoxy-9-(3-methoxyphenyl)-N-(4-methoxyphenyl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-imine |
| SMILES | COc1ccc(/N=C2\CC(C)(C)CC3=C2[C@@H](c2cccc(OC)c2)c2cc(OC)ccc2O3)cc1 |
| InChI | InChI=1S/C30H31NO4/c1-30(2)17-25(31-20-9-11-21(32-3)12-10-20)29-27(18-30)35-26-14-13-23(34-5)16-24(26)28(29)19-7-6-8-22(15-19)33-4/h6-16,28H,17-18H2,1-5H3/b31-25+/t28-/m0/s1 |
| InChIKey | GNLIRLHDCPZXIR-UJZYUHLBSA-N |
| XLogP | 7.08 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|