C28H33NO6 — CID 122218327
ethyl (E)-3-[(4S,5S)-3-benzhydryl-2-oxo-5-[(1S)-2-oxo-1-pentan-3-yloxyethyl]-1,3-oxazolidin-4-yl]prop-2-enoate (PubChem CID 122218327) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is ethyl (E)-3-[(4S,5S)-3-benzhydryl-2-oxo-5-[(1S)-2-oxo-1-pentan-3-yloxyethyl]-1,3-oxazolidin-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4S,5S)-3-benzhydryl-2-oxo-5-[(1S)-2-oxo-1-pentan-3-yloxyethyl]-1,3-oxazolidin-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 122218327 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | ethyl (E)-3-[(4S,5S)-3-benzhydryl-2-oxo-5-[(1S)-2-oxo-1-pentan-3-yloxyethyl]-1,3-oxazolidin-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1[C@@H]([C@@H](C=O)OC(CC)CC)OC(=O)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO6/c1-4-22(5-2)34-24(19-30)27-23(17-18-25(31)33-6-3)29(28(32)35-27)26(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-19,22-24,26-27H,4-6H2,1-3H3/b18-17+/t23-,24+,27-/m0/s1 |
| InChIKey | UDEOXCMHZRZDQX-FIZQUBDPSA-N |
| XLogP | 4.86 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|