C28H35NO6 — CID 134841687
ethyl (E)-3-[(4S,5S)-3-benzhydryl-5-[(1R)-2-hydroxy-1-pentan-3-yloxyethyl]-2-oxo-1,3-oxazolidin-4-yl]prop-2-enoate (PubChem CID 134841687) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is ethyl (E)-3-[(4S,5S)-3-benzhydryl-5-[(1R)-2-hydroxy-1-pentan-3-yloxyethyl]-2-oxo-1,3-oxazolidin-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4S,5S)-3-benzhydryl-5-[(1R)-2-hydroxy-1-pentan-3-yloxyethyl]-2-oxo-1,3-oxazolidin-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134841687 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | ethyl (E)-3-[(4S,5S)-3-benzhydryl-5-[(1R)-2-hydroxy-1-pentan-3-yloxyethyl]-2-oxo-1,3-oxazolidin-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1[C@@H]([C@@H](CO)OC(CC)CC)OC(=O)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35NO6/c1-4-22(5-2)34-24(19-30)27-23(17-18-25(31)33-6-3)29(28(32)35-27)26(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-18,22-24,26-27,30H,4-6,19H2,1-3H3/b18-17+/t23-,24+,27-/m0/s1 |
| InChIKey | BYKVVSJEIDRLLP-FIZQUBDPSA-N |
| XLogP | 4.65 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|