C30H35NO4Si — CID 139089680
(4S,5R)-3-benzyl-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-4-ethenyl-1,3-oxazolidin-2-one (PubChem CID 139089680) has the molecular formula C30H35NO4Si and a molecular weight of 501.70 g/mol. Its IUPAC name is (4S,5R)-3-benzyl-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-4-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-benzyl-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-4-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139089680 |
| Molecular Formula | C30H35NO4Si |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | (4S,5R)-3-benzyl-5-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-4-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H]1[C@H]([C@H](O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H35NO4Si/c1-5-26-28(35-29(33)31(26)21-23-15-9-6-10-16-23)27(32)22-34-36(30(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h5-20,26-28,32H,1,21-22H2,2-4H3/t26-,27+,28+/m0/s1 |
| InChIKey | YAOAYZFLJMUVPO-UPRLRBBYSA-N |
| XLogP | 4.50 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|