C35H46N2O4Si — CID 15441173
tert-butyl (2S,4R)-2-[(1S)-1-[benzyl(hydroxy)amino]prop-2-enyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 15441173) has the molecular formula C35H46N2O4Si and a molecular weight of 586.85 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(1S)-1-[benzyl(hydroxy)amino]prop-2-enyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[(1S)-1-[benzyl(hydroxy)amino]prop-2-enyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15441173 |
| Molecular Formula | C35H46N2O4Si |
| Molecular Weight | 586.85 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(1S)-1-[benzyl(hydroxy)amino]prop-2-enyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]([C@@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN1C(=O)OC(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C35H46N2O4Si/c1-8-31(37(39)25-27-18-12-9-13-19-27)32-24-28(26-36(32)33(38)40-34(2,3)4)41-42(35(5,6)7,29-20-14-10-15-21-29)30-22-16-11-17-23-30/h8-23,28,31-32,39H,1,24-26H2,2-7H3/t28-,31+,32+/m1/s1 |
| InChIKey | WGRVADJPYYRTQY-DPFTZIENSA-N |
| XLogP | 6.39 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.85 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|