C36H50N2O4Si2 — CID 11802143
tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-[tert-butyl(diphenyl)silyl]oxy-5-trimethylsilylpent-4-yn-2-yl]carbamate (PubChem CID 11802143) has the molecular formula C36H50N2O4Si2 and a molecular weight of 630.98 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-[tert-butyl(diphenyl)silyl]oxy-5-trimethylsilylpent-4-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-[tert-butyl(diphenyl)silyl]oxy-5-trimethylsilylpent-4-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 11802143 |
| Molecular Formula | C36H50N2O4Si2 |
| Molecular Weight | 630.98 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-[tert-butyl(diphenyl)silyl]oxy-5-trimethylsilylpent-4-yn-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C#C[Si](C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C36H50N2O4Si2/c1-35(2,3)42-34(39)37-32(33(25-26-43(7,8)9)38(40)27-29-19-13-10-14-20-29)28-41-44(36(4,5)6,30-21-15-11-16-22-30)31-23-17-12-18-24-31/h10-24,32-33,40H,27-28H2,1-9H3,(H,37,39)/t32-,33+/m0/s1 |
| InChIKey | VVCAZUYSQSJOKO-JHOUSYSJSA-N |
| XLogP | 6.60 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.98 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|