C32H44N2O4Si — CID 10886125
tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate (PubChem CID 10886125) has the molecular formula C32H44N2O4Si and a molecular weight of 548.80 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10886125 |
| Molecular Formula | C32H44N2O4Si |
| Molecular Weight | 548.80 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]carbamate |
| SMILES | C[C@H]([C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C32H44N2O4Si/c1-25(34(36)23-26-17-11-8-12-18-26)29(33-30(35)38-31(2,3)4)24-37-39(32(5,6)7,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h8-22,25,29,36H,23-24H2,1-7H3,(H,33,35)/t25-,29+/m1/s1 |
| InChIKey | PKFJINOFYIJLLL-IRPSRAIASA-N |
| XLogP | 5.74 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.80 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|