C20H34N2O5Si — CID 11475389
tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-nitro-1-phenylpropyl]carbamate (PubChem CID 11475389) has the molecular formula C20H34N2O5Si and a molecular weight of 410.59 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-nitro-1-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-nitro-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 11475389 |
| Molecular Formula | C20H34N2O5Si |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | tert-butyl N-[(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-nitro-1-phenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccccc1)[C@H](CO[Si](C)(C)C(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C20H34N2O5Si/c1-19(2,3)27-18(23)21-17(15-12-10-9-11-13-15)16(22(24)25)14-26-28(7,8)20(4,5)6/h9-13,16-17H,14H2,1-8H3,(H,21,23)/t16-,17+/m0/s1 |
| InChIKey | MBEBXGNYRFPXRT-DLBZAZTESA-N |
| XLogP | 4.92 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|