C16H24N2O5 — CID 101396603
tert-butyl N-[(1R,2S)-5-hydroxy-2-nitro-1-phenylpentyl]carbamate (PubChem CID 101396603) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-5-hydroxy-2-nitro-1-phenylpentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-5-hydroxy-2-nitro-1-phenylpentyl]carbamate |
|---|---|
| PubChem CID | 101396603 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | tert-butyl N-[(1R,2S)-5-hydroxy-2-nitro-1-phenylpentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccccc1)[C@H](CCCO)[N+](=O)[O-] |
| InChI | InChI=1S/C16H24N2O5/c1-16(2,3)23-15(20)17-14(12-8-5-4-6-9-12)13(18(21)22)10-7-11-19/h4-6,8-9,13-14,19H,7,10-11H2,1-3H3,(H,17,20)/t13-,14+/m0/s1 |
| InChIKey | HIRSLTIBGJHUNE-UONOGXRCSA-N |
| XLogP | 2.67 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|