C17H23F3N2O7S — CID 101396604
[(4S,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] trifluoromethanesulfonate (PubChem CID 101396604) has the molecular formula C17H23F3N2O7S and a molecular weight of 456.44 g/mol. Its IUPAC name is [(4S,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] trifluoromethanesulfonate.
| Compound Name | [(4S,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101396604 |
| Molecular Formula | C17H23F3N2O7S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | [(4S,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-nitro-5-phenylpentyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccccc1)[C@H](CCCOS(=O)(=O)C(F)(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C17H23F3N2O7S/c1-16(2,3)29-15(23)21-14(12-8-5-4-6-9-12)13(22(24)25)10-7-11-28-30(26,27)17(18,19)20/h4-6,8-9,13-14H,7,10-11H2,1-3H3,(H,21,23)/t13-,14+/m0/s1 |
| InChIKey | BFZIIPYBRZEEHH-UONOGXRCSA-N |
| XLogP | 3.54 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|